C13H25N3O4 — CID 87998149
tert-butyl N-(5-acetamido-6-amino-6-oxohexyl)carbamate (PubChem CID 87998149) has the molecular formula C13H25N3O4 and a molecular weight of 287.36 g/mol. Its IUPAC name is tert-butyl N-(5-acetamido-6-amino-6-oxohexyl)carbamate.
| Compound Name | tert-butyl N-(5-acetamido-6-amino-6-oxohexyl)carbamate |
|---|---|
| PubChem CID | 87998149 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | tert-butyl N-(5-acetamido-6-amino-6-oxohexyl)carbamate |
| SMILES | CC(=O)NC(CCCCNC(=O)OC(C)(C)C)C(N)=O |
| InChI | InChI=1S/C13H25N3O4/c1-9(17)16-10(11(14)18)7-5-6-8-15-12(19)20-13(2,3)4/h10H,5-8H2,1-4H3,(H2,14,18)(H,15,19)(H,16,17) |
| InChIKey | OJYIJPHPOZMKMZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|