C17H33N3O4 — CID 58480322
tert-butyl N-[(5S)-5-acetamido-9-(methylamino)-6-oxononyl]carbamate (PubChem CID 58480322) has the molecular formula C17H33N3O4 and a molecular weight of 343.47 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5-acetamido-9-(methylamino)-6-oxononyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5-acetamido-9-(methylamino)-6-oxononyl]carbamate |
|---|---|
| PubChem CID | 58480322 |
| Molecular Formula | C17H33N3O4 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | tert-butyl N-[(5S)-5-acetamido-9-(methylamino)-6-oxononyl]carbamate |
| SMILES | CNCCCC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(C)=O |
| InChI | InChI=1S/C17H33N3O4/c1-13(21)20-14(15(22)10-8-11-18-5)9-6-7-12-19-16(23)24-17(2,3)4/h14,18H,6-12H2,1-5H3,(H,19,23)(H,20,21)/t14-/m0/s1 |
| InChIKey | ZJFOJAJRPUEYKR-AWEZNQCLSA-N |
| XLogP | 1.75 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|