C38H72N6O10 — CID 123364045
tert-butyl N-[1-[6-[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]hexylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl]carbamate (PubChem CID 123364045) has the molecular formula C38H72N6O10 and a molecular weight of 773.03 g/mol. Its IUPAC name is tert-butyl N-[1-[6-[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]hexylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[6-[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]hexylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 123364045 |
| Molecular Formula | C38H72N6O10 |
| Molecular Weight | 773.03 g/mol |
| Exact Mass | 772.53 |
| IUPAC Name | tert-butyl N-[1-[6-[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]hexylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(NC(=O)OC(C)(C)C)C(=O)NCCCCCCNC(=O)C(CCCCNC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H72N6O10/c1-35(2,3)51-31(47)41-25-19-15-21-27(43-33(49)53-37(7,8)9)29(45)39-23-17-13-14-18-24-40-30(46)28(44-34(50)54-38(10,11)12)22-16-20-26-42-32(48)52-36(4,5)6/h27-28H,13-26H2,1-12H3,(H,39,45)(H,40,46)(H,41,47)(H,42,48)(H,43,49)(H,44,50) |
| InChIKey | NZRSSPKEGLISGL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 211.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.03 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|