C16H31N3O4S — CID 87186009
tert-butyl N-[(2S)-1-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-sulfanylidenehexan-2-yl]carbamate (PubChem CID 87186009) has the molecular formula C16H31N3O4S and a molecular weight of 361.51 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-sulfanylidenehexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-sulfanylidenehexan-2-yl]carbamate |
|---|---|
| PubChem CID | 87186009 |
| Molecular Formula | C16H31N3O4S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | tert-butyl N-[(2S)-1-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-sulfanylidenehexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)OC(C)(C)C)C(N)=S |
| InChI | InChI=1S/C16H31N3O4S/c1-15(2,3)22-13(20)18-10-8-7-9-11(12(17)24)19-14(21)23-16(4,5)6/h11H,7-10H2,1-6H3,(H2,17,24)(H,18,20)(H,19,21)/t11-/m0/s1 |
| InChIKey | FKJIBGTVTBCAFB-NSHDSACASA-N |
| XLogP | 2.86 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|