C16H31N3O4S — CID 87186010
tert-butyl (2S)-2,7-diamino-6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-sulfanylideneheptanoate (PubChem CID 87186010) has the molecular formula C16H31N3O4S and a molecular weight of 361.51 g/mol. Its IUPAC name is tert-butyl (2S)-2,7-diamino-6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-sulfanylideneheptanoate.
| Compound Name | tert-butyl (2S)-2,7-diamino-6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-sulfanylideneheptanoate |
|---|---|
| PubChem CID | 87186010 |
| Molecular Formula | C16H31N3O4S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | tert-butyl (2S)-2,7-diamino-6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-sulfanylideneheptanoate |
| SMILES | CC(C)(C)OC(=O)NC(CCC[C@H](N)C(=O)OC(C)(C)C)C(N)=S |
| InChI | InChI=1S/C16H31N3O4S/c1-15(2,3)22-13(20)10(17)8-7-9-11(12(18)24)19-14(21)23-16(4,5)6/h10-11H,7-9,17H2,1-6H3,(H2,18,24)(H,19,21)/t10-,11?/m0/s1 |
| InChIKey | UAOSVBLYTKJWCP-VUWPPUDQSA-N |
| XLogP | 2.01 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|