C15H31ClN2O4 — CID 159470868
tert-butyl (2S)-6-(15N)azanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;hydrochloride (PubChem CID 159470868) has the molecular formula C15H31ClN2O4 and a molecular weight of 339.87 g/mol. Its IUPAC name is tert-butyl (2S)-6-(15N)azanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;hydrochloride.
| Compound Name | tert-butyl (2S)-6-(15N)azanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;hydrochloride |
|---|---|
| PubChem CID | 159470868 |
| Molecular Formula | C15H31ClN2O4 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | tert-butyl (2S)-6-(15N)azanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCC[15NH2])C(=O)OC(C)(C)C.Cl |
| InChI | InChI=1S/C15H30N2O4.ClH/c1-14(2,3)20-12(18)11(9-7-8-10-16)17-13(19)21-15(4,5)6;/h11H,7-10,16H2,1-6H3,(H,17,19);1H/t11-;/m0./s1/i16+1; |
| InChIKey | DZPNNJVSGWQNCP-MHVGXVTBSA-N |
| XLogP | 2.77 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|