C15H30N3O4P — CID 177045475
tert-butyl N-[6-(ethylamino)-6-oxo-5-[(2-phosphanylacetyl)amino]hexyl]carbamate (PubChem CID 177045475) has the molecular formula C15H30N3O4P and a molecular weight of 347.40 g/mol. Its IUPAC name is tert-butyl N-[6-(ethylamino)-6-oxo-5-[(2-phosphanylacetyl)amino]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-(ethylamino)-6-oxo-5-[(2-phosphanylacetyl)amino]hexyl]carbamate |
|---|---|
| PubChem CID | 177045475 |
| Molecular Formula | C15H30N3O4P |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | tert-butyl N-[6-(ethylamino)-6-oxo-5-[(2-phosphanylacetyl)amino]hexyl]carbamate |
| SMILES | CCNC(=O)C(CCCCNC(=O)OC(C)(C)C)NC(=O)CP |
| InChI | InChI=1S/C15H30N3O4P/c1-5-16-13(20)11(18-12(19)10-23)8-6-7-9-17-14(21)22-15(2,3)4/h11H,5-10,23H2,1-4H3,(H,16,20)(H,17,21)(H,18,19) |
| InChIKey | PEDDLCQGXABNOL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|