C17H36BN3O3 — CID 159132544
tert-butyl N-[(5S)-6-(1-dimethylboranylethylamino)-5-(ethylamino)-6-oxohexyl]carbamate (PubChem CID 159132544) has the molecular formula C17H36BN3O3 and a molecular weight of 341.31 g/mol. Its IUPAC name is tert-butyl N-[(5S)-6-(1-dimethylboranylethylamino)-5-(ethylamino)-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-6-(1-dimethylboranylethylamino)-5-(ethylamino)-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 159132544 |
| Molecular Formula | C17H36BN3O3 |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | tert-butyl N-[(5S)-6-(1-dimethylboranylethylamino)-5-(ethylamino)-6-oxohexyl]carbamate |
| SMILES | CCN[C@@H](CCCCNC(=O)OC(C)(C)C)C(=O)NC(C)B(C)C |
| InChI | InChI=1S/C17H36BN3O3/c1-8-19-14(15(22)21-13(2)18(6)7)11-9-10-12-20-16(23)24-17(3,4)5/h13-14,19H,8-12H2,1-7H3,(H,20,23)(H,21,22)/t13?,14-/m0/s1 |
| InChIKey | CRDBONVAJUJWTC-KZUDCZAMSA-N |
| XLogP | 2.46 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|