C44H69F5N6O12 — CID 58455228
(2,3,4,5,6-pentafluorophenyl) 2,6-bis[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]hexanoate (PubChem CID 58455228) has the molecular formula C44H69F5N6O12 and a molecular weight of 969.06 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2,6-bis[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]hexanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2,6-bis[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]hexanoate |
|---|---|
| PubChem CID | 58455228 |
| Molecular Formula | C44H69F5N6O12 |
| Molecular Weight | 969.06 g/mol |
| Exact Mass | 968.49 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2,6-bis[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]hexanoate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(NC(=O)OC(C)(C)C)C(=O)NCCCCC(NC(=O)C(CCCCNC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C44H69F5N6O12/c1-41(2,3)64-37(59)51-23-17-13-19-25(54-39(61)66-43(7,8)9)34(56)50-22-16-15-21-27(36(58)63-33-31(48)29(46)28(45)30(47)32(33)49)53-35(57)26(55-40(62)67-44(10,11)12)20-14-18-24-52-38(60)65-42(4,5)6/h25-27H,13-24H2,1-12H3,(H,50,56)(H,51,59)(H,52,60)(H,53,57)(H,54,61)(H,55,62) |
| InChIKey | NLXGCSYSKXYDFJ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 237.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 67 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.06 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|