C10H17N2O4- — CID 78438708
2,6-diacetamidohexanoate (PubChem CID 78438708) has the molecular formula C10H17N2O4- and a molecular weight of 229.26 g/mol. Its IUPAC name is 2,6-diacetamidohexanoate.
| Compound Name | 2,6-diacetamidohexanoate |
|---|---|
| PubChem CID | 78438708 |
| Molecular Formula | C10H17N2O4- |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 2,6-diacetamidohexanoate |
| SMILES | CC(=O)NCCCCC(NC(C)=O)C(=O)[O-] |
| InChI | InChI=1S/C10H18N2O4/c1-7(13)11-6-4-3-5-9(10(15)16)12-8(2)14/h9H,3-6H2,1-2H3,(H,11,13)(H,12,14)(H,15,16)/p-1 |
| InChIKey | ZHZUEHHBTYJTKY-UHFFFAOYSA-M |
| XLogP | -1.45 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|