C8H15N4O4- — CID 2512810
(2S)-2,6-bis(carbamoylamino)hexanoate (PubChem CID 2512810) has the molecular formula C8H15N4O4- and a molecular weight of 231.23 g/mol. Its IUPAC name is (2S)-2,6-bis(carbamoylamino)hexanoate.
| Compound Name | (2S)-2,6-bis(carbamoylamino)hexanoate |
|---|---|
| PubChem CID | 2512810 |
| Molecular Formula | C8H15N4O4- |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (2S)-2,6-bis(carbamoylamino)hexanoate |
| SMILES | NC(=O)NCCCC[C@H](NC(N)=O)C(=O)[O-] |
| InChI | InChI=1S/C8H16N4O4/c9-7(15)11-4-2-1-3-5(6(13)14)12-8(10)16/h5H,1-4H2,(H,13,14)(H3,9,11,15)(H3,10,12,16)/p-1/t5-/m0/s1 |
| InChIKey | MIKBDBZLKXLZTM-YFKPBYRVSA-M |
| XLogP | -2.39 |
| TPSA | 150.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|