C6H8N2O5Zn — CID 175394718
zinc (2S)-2-(carbamoylamino)pentanedioate (PubChem CID 175394718) has the molecular formula C6H8N2O5Zn and a molecular weight of 253.53 g/mol. Its IUPAC name is zinc (2S)-2-(carbamoylamino)pentanedioate.
| Compound Name | zinc (2S)-2-(carbamoylamino)pentanedioate |
|---|---|
| PubChem CID | 175394718 |
| Molecular Formula | C6H8N2O5Zn |
| Molecular Weight | 253.53 g/mol |
| Exact Mass | 251.97 |
| IUPAC Name | zinc (2S)-2-(carbamoylamino)pentanedioate |
| SMILES | NC(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-].[Zn+2] |
| InChI | InChI=1S/C6H10N2O5.Zn/c7-6(13)8-3(5(11)12)1-2-4(9)10;/h3H,1-2H2,(H,9,10)(H,11,12)(H3,7,8,13);/q;+2/p-2/t3-;/m0./s1 |
| InChIKey | QDRJXUBGJYBJNG-DFWYDOINSA-L |
| XLogP | -3.70 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.53 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|