C11H14N3O8-3 — CID 119058130
(2S)-2-[[2-[[(2S)-2-amino-3-carboxylatopropanoyl]amino]acetyl]amino]pentanedioate (PubChem CID 119058130) has the molecular formula C11H14N3O8-3 and a molecular weight of 316.25 g/mol. Its IUPAC name is (2S)-2-[[2-[[(2S)-2-amino-3-carboxylatopropanoyl]amino]acetyl]amino]pentanedioate.
| Compound Name | (2S)-2-[[2-[[(2S)-2-amino-3-carboxylatopropanoyl]amino]acetyl]amino]pentanedioate |
|---|---|
| PubChem CID | 119058130 |
| Molecular Formula | C11H14N3O8-3 |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | (2S)-2-[[2-[[(2S)-2-amino-3-carboxylatopropanoyl]amino]acetyl]amino]pentanedioate |
| SMILES | N[C@@H](CC(=O)[O-])C(=O)NCC(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C11H17N3O8/c12-5(3-9(18)19)10(20)13-4-7(15)14-6(11(21)22)1-2-8(16)17/h5-6H,1-4,12H2,(H,13,20)(H,14,15)(H,16,17)(H,18,19)(H,21,22)/p-3/t5-,6-/m0/s1 |
| InChIKey | VIRHEUMYXXLCBF-WDSKDSINSA-K |
| XLogP | -6.67 |
| TPSA | 204.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | -6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |