C8H11NNa2O5S — CID 86593470
disodium;(2S)-2-(3-sulfanylpropanoylamino)pentanedioate (PubChem CID 86593470) has the molecular formula C8H11NNa2O5S and a molecular weight of 279.23 g/mol. Its IUPAC name is disodium;(2S)-2-(3-sulfanylpropanoylamino)pentanedioate.
| Compound Name | disodium;(2S)-2-(3-sulfanylpropanoylamino)pentanedioate |
|---|---|
| PubChem CID | 86593470 |
| Molecular Formula | C8H11NNa2O5S |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | disodium;(2S)-2-(3-sulfanylpropanoylamino)pentanedioate |
| SMILES | O=C([O-])CC[C@H](NC(=O)CCS)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H13NO5S.2Na/c10-6(3-4-15)9-5(8(13)14)1-2-7(11)12;;/h5,15H,1-4H2,(H,9,10)(H,11,12)(H,13,14);;/q;2*+1/p-2/t5-;;/m0../s1 |
| InChIKey | XQBUBHFSTWGZPH-XRIGFGBMSA-L |
| XLogP | -8.92 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | -8.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|