C13H21NNa2O5S2 — CID 141084417
disodium;(2S)-2-[6,8-bis(sulfanyl)octanoylamino]pentanedioate (PubChem CID 141084417) has the molecular formula C13H21NNa2O5S2 and a molecular weight of 381.43 g/mol. Its IUPAC name is disodium;(2S)-2-[6,8-bis(sulfanyl)octanoylamino]pentanedioate.
| Compound Name | disodium;(2S)-2-[6,8-bis(sulfanyl)octanoylamino]pentanedioate |
|---|---|
| PubChem CID | 141084417 |
| Molecular Formula | C13H21NNa2O5S2 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | disodium;(2S)-2-[6,8-bis(sulfanyl)octanoylamino]pentanedioate |
| SMILES | O=C([O-])CC[C@H](NC(=O)CCCCC(S)CCS)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C13H23NO5S2.2Na/c15-11(4-2-1-3-9(21)7-8-20)14-10(13(18)19)5-6-12(16)17;;/h9-10,20-21H,1-8H2,(H,14,15)(H,16,17)(H,18,19);;/q;2*+1/p-2/t9?,10-;;/m0../s1 |
| InChIKey | LBZWOQNNSYFJRM-NYMKFKOJSA-L |
| XLogP | -7.06 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | -7.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|