C22H38N2O8S2 — CID 144960734
2-[[2-[6,8-bis(sulfanyl)octanoylamino]-4-carboxybutanoyl]amino]pentanedioic acid;but-2-ene (PubChem CID 144960734) has the molecular formula C22H38N2O8S2 and a molecular weight of 522.69 g/mol. Its IUPAC name is 2-[[2-[6,8-bis(sulfanyl)octanoylamino]-4-carboxybutanoyl]amino]pentanedioic acid;but-2-ene.
| Compound Name | 2-[[2-[6,8-bis(sulfanyl)octanoylamino]-4-carboxybutanoyl]amino]pentanedioic acid;but-2-ene |
|---|---|
| PubChem CID | 144960734 |
| Molecular Formula | C22H38N2O8S2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 2-[[2-[6,8-bis(sulfanyl)octanoylamino]-4-carboxybutanoyl]amino]pentanedioic acid;but-2-ene |
| SMILES | CC=CC.O=C(O)CCC(NC(=O)C(CCC(=O)O)NC(=O)CCCCC(S)CCS)C(=O)O |
| InChI | InChI=1S/C18H30N2O8S2.C4H8/c21-14(4-2-1-3-11(30)9-10-29)19-12(5-7-15(22)23)17(26)20-13(18(27)28)6-8-16(24)25;1-3-4-2/h11-13,29-30H,1-10H2,(H,19,21)(H,20,26)(H,22,23)(H,24,25)(H,27,28);3-4H,1-2H3 |
| InChIKey | JVTYDHDGIKMSNB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 170.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|