C17H34N2O3S — CID 140657755
2-(13-azaniumyltridecanoylamino)-4-sulfanylbutanoate (PubChem CID 140657755) has the molecular formula C17H34N2O3S and a molecular weight of 346.54 g/mol. Its IUPAC name is 2-(13-azaniumyltridecanoylamino)-4-sulfanylbutanoate.
| Compound Name | 2-(13-azaniumyltridecanoylamino)-4-sulfanylbutanoate |
|---|---|
| PubChem CID | 140657755 |
| Molecular Formula | C17H34N2O3S |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 2-(13-azaniumyltridecanoylamino)-4-sulfanylbutanoate |
| SMILES | [NH3+]CCCCCCCCCCCCC(=O)NC(CCS)C(=O)[O-] |
| InChI | InChI=1S/C17H34N2O3S/c18-13-10-8-6-4-2-1-3-5-7-9-11-16(20)19-15(12-14-23)17(21)22/h15,23H,1-14,18H2,(H,19,20)(H,21,22) |
| InChIKey | RRZBRBNSPFFILM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|