C12H24N2O3S — CID 140657768
2-(9-azaniumylnonanoylamino)-3-sulfanylpropanoate (PubChem CID 140657768) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is 2-(9-azaniumylnonanoylamino)-3-sulfanylpropanoate.
| Compound Name | 2-(9-azaniumylnonanoylamino)-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 140657768 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-(9-azaniumylnonanoylamino)-3-sulfanylpropanoate |
| SMILES | [NH3+]CCCCCCCCC(=O)NC(CS)C(=O)[O-] |
| InChI | InChI=1S/C12H24N2O3S/c13-8-6-4-2-1-3-5-7-11(15)14-10(9-18)12(16)17/h10,18H,1-9,13H2,(H,14,15)(H,16,17) |
| InChIKey | VTFGFZZGIZBHEV-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|