C21H40LiNO3S — CID 87246339
lithium (2R)-2-(octadecanoylamino)-3-sulfanylpropanoate (PubChem CID 87246339) has the molecular formula C21H40LiNO3S and a molecular weight of 393.56 g/mol. Its IUPAC name is lithium (2R)-2-(octadecanoylamino)-3-sulfanylpropanoate.
| Compound Name | lithium (2R)-2-(octadecanoylamino)-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 87246339 |
| Molecular Formula | C21H40LiNO3S |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.29 |
| IUPAC Name | lithium (2R)-2-(octadecanoylamino)-3-sulfanylpropanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)N[C@@H](CS)C(=O)[O-].[Li+] |
| InChI | InChI=1S/C21H41NO3S.Li/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)22-19(18-26)21(24)25;/h19,26H,2-18H2,1H3,(H,22,23)(H,24,25);/q;+1/p-1/t19-;/m0./s1 |
| InChIKey | PUNISYZMIBYMAG-FYZYNONXSA-M |
| XLogP | 1.42 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|