C15H28NNaO3S — CID 71466595
sodium (2R)-2-(dodecanoylamino)-3-sulfanylpropanoate (PubChem CID 71466595) has the molecular formula C15H28NNaO3S and a molecular weight of 325.45 g/mol. Its IUPAC name is sodium (2R)-2-(dodecanoylamino)-3-sulfanylpropanoate.
| Compound Name | sodium (2R)-2-(dodecanoylamino)-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 71466595 |
| Molecular Formula | C15H28NNaO3S |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | sodium (2R)-2-(dodecanoylamino)-3-sulfanylpropanoate |
| SMILES | CCCCCCCCCCCC(=O)N[C@@H](CS)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C15H29NO3S.Na/c1-2-3-4-5-6-7-8-9-10-11-14(17)16-13(12-20)15(18)19;/h13,20H,2-12H2,1H3,(H,16,17)(H,18,19);/q;+1/p-1/t13-;/m0./s1 |
| InChIKey | BOBJYIGKWIIXEC-ZOWNYOTGSA-M |
| XLogP | -0.92 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|