C16H27K2NO5 — CID 87121612
dipotassium;(2S)-2-(dodecanoylamino)butanedioate (PubChem CID 87121612) has the molecular formula C16H27K2NO5 and a molecular weight of 391.59 g/mol. Its IUPAC name is dipotassium;(2S)-2-(dodecanoylamino)butanedioate.
| Compound Name | dipotassium;(2S)-2-(dodecanoylamino)butanedioate |
|---|---|
| PubChem CID | 87121612 |
| Molecular Formula | C16H27K2NO5 |
| Molecular Weight | 391.59 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | dipotassium;(2S)-2-(dodecanoylamino)butanedioate |
| SMILES | CCCCCCCCCCCC(=O)N[C@@H](CC(=O)[O-])C(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C16H29NO5.2K/c1-2-3-4-5-6-7-8-9-10-11-14(18)17-13(16(21)22)12-15(19)20;;/h13H,2-12H2,1H3,(H,17,18)(H,19,20)(H,21,22);;/q;2*+1/p-2/t13-;;/m0../s1 |
| InChIKey | SPDCLQHXQLECMT-GXKRWWSZSA-L |
| XLogP | -5.71 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.59 |
| LogP ≤ 5 | -5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|