C23H38KNO5 — CID 76960316
potassium;hydron;(2S)-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]pentanedioate (PubChem CID 76960316) has the molecular formula C23H38KNO5 and a molecular weight of 447.66 g/mol. Its IUPAC name is potassium;hydron;(2S)-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]pentanedioate.
| Compound Name | potassium;hydron;(2S)-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 76960316 |
| Molecular Formula | C23H38KNO5 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | potassium;hydron;(2S)-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]pentanedioate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-].[H+].[K+] |
| InChI | InChI=1S/C23H39NO5.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(25)24-20(23(28)29)18-19-22(26)27;/h6-7,9-10,20H,2-5,8,11-19H2,1H3,(H,24,25)(H,26,27)(H,28,29);/q;+1/p-1/b7-6-,10-9-;/t20-;/m0./s1 |
| InChIKey | UJBOGOLQZLUUJQ-VZKKWTCGSA-M |
| XLogP | -0.32 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|