C26H43O2- — CID 86289180
(11Z,14Z,17Z,20Z)-hexacosa-11,14,17,20-tetraenoate (PubChem CID 86289180) has the molecular formula C26H43O2- and a molecular weight of 387.63 g/mol. Its IUPAC name is (11Z,14Z,17Z,20Z)-hexacosa-11,14,17,20-tetraenoate.
| Compound Name | (11Z,14Z,17Z,20Z)-hexacosa-11,14,17,20-tetraenoate |
|---|---|
| PubChem CID | 86289180 |
| Molecular Formula | C26H43O2- |
| Molecular Weight | 387.63 g/mol |
| Exact Mass | 387.33 |
| IUPAC Name | (11Z,14Z,17Z,20Z)-hexacosa-11,14,17,20-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C26H44O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26(27)28/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-25H2,1H3,(H,27,28)/p-1/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | ICYODDOZZLYLIV-DOFZRALJSA-M |
| XLogP | 7.22 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.63 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|