C20H35NaO2 — CID 155906051
sodium (11Z,14Z)-icosa-11,14-dienoate (PubChem CID 155906051) has the molecular formula C20H35NaO2 and a molecular weight of 330.49 g/mol. Its IUPAC name is sodium (11Z,14Z)-icosa-11,14-dienoate.
| Compound Name | sodium (11Z,14Z)-icosa-11,14-dienoate |
|---|---|
| PubChem CID | 155906051 |
| Molecular Formula | C20H35NaO2 |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | sodium (11Z,14Z)-icosa-11,14-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C20H36O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22;/h6-7,9-10H,2-5,8,11-19H2,1H3,(H,21,22);/q;+1/p-1/b7-6-,10-9-; |
| InChIKey | IVNGKEHLXADBSB-NBTZWHCOSA-M |
| XLogP | 2.33 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|