sodium (11Z,14Z)-icosa-11,14-dienoate

C20H35NaO2 — CID 155906051

IUPACsodium (11Z,14Z)-icosa-11,14-dienoate
SMILESCCCCC/C=C\C/C=C\CCCCCCCCCC(=O)[O-].[Na+]
InChIInChI=1S/C20H36O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22;/h6-7,9-10H,2-5,8,11-19H2,1H3,(H,21,22);/q;+1/p-1/b7-6-,10-9-;
InChIKeyIVNGKEHLXADBSB-NBTZWHCOSA-M
MW330.49 g/mol
LogP2.33
Rot. Bonds16

About sodium (11Z,14Z)-icosa-11,14-dienoate

sodium (11Z,14Z)-icosa-11,14-dienoate (PubChem CID 155906051) has the molecular formula C20H35NaO2 and a molecular weight of 330.49 g/mol. Its IUPAC name is sodium (11Z,14Z)-icosa-11,14-dienoate.

Molecular Properties

Compound Namesodium (11Z,14Z)-icosa-11,14-dienoate
PubChem CID155906051
Molecular FormulaC20H35NaO2
Molecular Weight330.49 g/mol
Exact Mass330.25
IUPAC Namesodium (11Z,14Z)-icosa-11,14-dienoate
SMILESCCCCC/C=C\C/C=C\CCCCCCCCCC(=O)[O-].[Na+]
InChIInChI=1S/C20H36O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22;/h6-7,9-10H,2-5,8,11-19H2,1H3,(H,21,22);/q;+1/p-1/b7-6-,10-9-;
InChIKeyIVNGKEHLXADBSB-NBTZWHCOSA-M
XLogP2.33
TPSA40.13 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds16
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500330.49
LogP ≤ 52.33
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze sodium (11Z,14Z)-icosa-11,14-dienoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium (11Z,14Z)-icosa-11,14-dienoate?
The IUPAC name of sodium (11Z,14Z)-icosa-11,14-dienoate (CID 155906051) is sodium (11Z,14Z)-icosa-11,14-dienoate.
What is the SMILES notation for sodium (11Z,14Z)-icosa-11,14-dienoate?
The canonical SMILES for sodium (11Z,14Z)-icosa-11,14-dienoate is CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)[O-].[Na+].
What is the InChIKey of sodium (11Z,14Z)-icosa-11,14-dienoate?
The InChIKey is IVNGKEHLXADBSB-NBTZWHCOSA-M. The full InChI is InChI=1S/C20H36O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22;/h6-7,9-10H,2-5,8,11-19H2,1H3,(H,21,22);/q;+1/p-1/b7-6-,10-9-;.
What are the key properties of sodium (11Z,14Z)-icosa-11,14-dienoate?
sodium (11Z,14Z)-icosa-11,14-dienoate has a molecular weight of 330.49 g/mol, XLogP of 2.33, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (11Z,14Z)-icosa-11,14-dienoate is sourced from PubChem (CID 155906051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).