C18H34NaO6P — CID 175132499
sodium;(9Z,12Z)-octadeca-9,12-dienoate;phosphoric acid (PubChem CID 175132499) has the molecular formula C18H34NaO6P and a molecular weight of 400.43 g/mol. Its IUPAC name is sodium;(9Z,12Z)-octadeca-9,12-dienoate;phosphoric acid.
| Compound Name | sodium;(9Z,12Z)-octadeca-9,12-dienoate;phosphoric acid |
|---|---|
| PubChem CID | 175132499 |
| Molecular Formula | C18H34NaO6P |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | sodium;(9Z,12Z)-octadeca-9,12-dienoate;phosphoric acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)[O-].O=P(O)(O)O.[Na+] |
| InChI | InChI=1S/C18H32O2.Na.H3O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;;1-5(2,3)4/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20);;(H3,1,2,3,4)/q;+1;/p-1/b7-6-,10-9-;; |
| InChIKey | UNJPCCIMVOMRMG-JFHYDWJLSA-M |
| XLogP | 0.63 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|