C20H33O2- — CID 40575468
(5Z,11Z,14Z)-icosa-5,11,14-trienoate (PubChem CID 40575468) has the molecular formula C20H33O2- and a molecular weight of 305.48 g/mol. Its IUPAC name is (5Z,11Z,14Z)-icosa-5,11,14-trienoate.
| Compound Name | (5Z,11Z,14Z)-icosa-5,11,14-trienoate |
|---|---|
| PubChem CID | 40575468 |
| Molecular Formula | C20H33O2- |
| Molecular Weight | 305.48 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | (5Z,11Z,14Z)-icosa-5,11,14-trienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCC/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,15-16H,2-5,8,11-14,17-19H2,1H3,(H,21,22)/p-1/b7-6-,10-9-,16-15- |
| InChIKey | PRHHYVQTPBEDFE-URZBRJKDSA-M |
| XLogP | 5.11 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|