C19H29NaO2 — CID 177254323
sodium (4Z,7Z,10Z,13Z)-nonadeca-4,7,10,13-tetraenoate (PubChem CID 177254323) has the molecular formula C19H29NaO2 and a molecular weight of 312.43 g/mol. Its IUPAC name is sodium (4Z,7Z,10Z,13Z)-nonadeca-4,7,10,13-tetraenoate.
| Compound Name | sodium (4Z,7Z,10Z,13Z)-nonadeca-4,7,10,13-tetraenoate |
|---|---|
| PubChem CID | 177254323 |
| Molecular Formula | C19H29NaO2 |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | sodium (4Z,7Z,10Z,13Z)-nonadeca-4,7,10,13-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C19H30O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21;/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-18H2,1H3,(H,20,21);/q;+1/p-1/b7-6-,10-9-,13-12-,16-15-; |
| InChIKey | FSFOGQZMTLDNPA-XVSDJDOKSA-M |
| XLogP | 1.50 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|