C22H37O2- — CID 86289994
(10Z,13Z,16Z)-docosa-10,13,16-trienoate (PubChem CID 86289994) has the molecular formula C22H37O2- and a molecular weight of 333.54 g/mol. Its IUPAC name is (10Z,13Z,16Z)-docosa-10,13,16-trienoate.
| Compound Name | (10Z,13Z,16Z)-docosa-10,13,16-trienoate |
|---|---|
| PubChem CID | 86289994 |
| Molecular Formula | C22H37O2- |
| Molecular Weight | 333.54 g/mol |
| Exact Mass | 333.28 |
| IUPAC Name | (10Z,13Z,16Z)-docosa-10,13,16-trienoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C22H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h6-7,9-10,12-13H,2-5,8,11,14-21H2,1H3,(H,23,24)/p-1/b7-6-,10-9-,13-12- |
| InChIKey | RILVNGKQIULBOQ-QNEBEIHSSA-M |
| XLogP | 5.89 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|