C23H37O2- — CID 140590497
(8Z,11Z,14Z,17Z)-tricosa-8,11,14,17-tetraenoate (PubChem CID 140590497) has the molecular formula C23H37O2- and a molecular weight of 345.55 g/mol. Its IUPAC name is (8Z,11Z,14Z,17Z)-tricosa-8,11,14,17-tetraenoate.
| Compound Name | (8Z,11Z,14Z,17Z)-tricosa-8,11,14,17-tetraenoate |
|---|---|
| PubChem CID | 140590497 |
| Molecular Formula | C23H37O2- |
| Molecular Weight | 345.55 g/mol |
| Exact Mass | 345.28 |
| IUPAC Name | (8Z,11Z,14Z,17Z)-tricosa-8,11,14,17-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)[O-] |
| InChI | InChI=1S/C23H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-22H2,1H3,(H,24,25)/p-1/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | RIIQLVDUSDXYRO-DOFZRALJSA-M |
| XLogP | 6.05 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.55 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|