C27H53NO5S — CID 157493011
dodecanoic acid;(2R)-2-(dodecanoylamino)-3-sulfanylpropanoic acid (PubChem CID 157493011) has the molecular formula C27H53NO5S and a molecular weight of 503.79 g/mol. Its IUPAC name is dodecanoic acid;(2R)-2-(dodecanoylamino)-3-sulfanylpropanoic acid.
| Compound Name | dodecanoic acid;(2R)-2-(dodecanoylamino)-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 157493011 |
| Molecular Formula | C27H53NO5S |
| Molecular Weight | 503.79 g/mol |
| Exact Mass | 503.36 |
| IUPAC Name | dodecanoic acid;(2R)-2-(dodecanoylamino)-3-sulfanylpropanoic acid |
| SMILES | CCCCCCCCCCCC(=O)N[C@@H](CS)C(=O)O.CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C15H29NO3S.C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-14(17)16-13(12-20)15(18)19;1-2-3-4-5-6-7-8-9-10-11-12(13)14/h13,20H,2-12H2,1H3,(H,16,17)(H,18,19);2-11H2,1H3,(H,13,14)/t13-;/m0./s1 |
| InChIKey | BXMRRCADSPQRSH-ZOWNYOTGSA-N |
| XLogP | 7.40 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.79 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|