C11H20NNaO4S2 — CID 141084420
sodium (2S)-2-[6,8-bis(sulfanyl)octanoylamino]-3-hydroxypropanoate (PubChem CID 141084420) has the molecular formula C11H20NNaO4S2 and a molecular weight of 317.41 g/mol. Its IUPAC name is sodium (2S)-2-[6,8-bis(sulfanyl)octanoylamino]-3-hydroxypropanoate.
| Compound Name | sodium (2S)-2-[6,8-bis(sulfanyl)octanoylamino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 141084420 |
| Molecular Formula | C11H20NNaO4S2 |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | sodium (2S)-2-[6,8-bis(sulfanyl)octanoylamino]-3-hydroxypropanoate |
| SMILES | O=C(CCCCC(S)CCS)N[C@@H](CO)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C11H21NO4S2.Na/c13-7-9(11(15)16)12-10(14)4-2-1-3-8(18)5-6-17;/h8-9,13,17-18H,1-7H2,(H,12,14)(H,15,16);/q;+1/p-1/t8?,9-;/m0./s1 |
| InChIKey | IIBJMMYSFPMUPD-MTFPJWTKSA-M |
| XLogP | -3.60 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|