C26H48N2O6S6Zn — CID 87408283
zinc bis((2S)-2-[6,8-bis(sulfanyl)octanoylamino]-4-methylsulfanylbutanoate) (PubChem CID 87408283) has the molecular formula C26H48N2O6S6Zn and a molecular weight of 742.47 g/mol. Its IUPAC name is zinc bis((2S)-2-[6,8-bis(sulfanyl)octanoylamino]-4-methylsulfanylbutanoate).
| Compound Name | zinc bis((2S)-2-[6,8-bis(sulfanyl)octanoylamino]-4-methylsulfanylbutanoate) |
|---|---|
| PubChem CID | 87408283 |
| Molecular Formula | C26H48N2O6S6Zn |
| Molecular Weight | 742.47 g/mol |
| Exact Mass | 740.11 |
| IUPAC Name | zinc bis((2S)-2-[6,8-bis(sulfanyl)octanoylamino]-4-methylsulfanylbutanoate) |
| SMILES | CSCC[C@H](NC(=O)CCCCC(S)CCS)C(=O)[O-].CSCC[C@H](NC(=O)CCCCC(S)CCS)C(=O)[O-].[Zn+2] |
| InChI | InChI=1S/2C13H25NO3S3.Zn/c2*1-20-9-7-11(13(16)17)14-12(15)5-3-2-4-10(19)6-8-18;/h2*10-11,18-19H,2-9H2,1H3,(H,14,15)(H,16,17);/q;;+2/p-2/t2*10?,11-;/m00./s1 |
| InChIKey | DXKMJMGNEIEDEU-MJVSTKRKSA-L |
| XLogP | 2.30 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|