C14H24MnN2O6S2 — CID 71587405
bis((2S)-2-acetamido-4-methylsulfanylbutanoate);manganese(2+) (PubChem CID 71587405) has the molecular formula C14H24MnN2O6S2 and a molecular weight of 435.43 g/mol. Its IUPAC name is bis((2S)-2-acetamido-4-methylsulfanylbutanoate);manganese(2+).
| Compound Name | bis((2S)-2-acetamido-4-methylsulfanylbutanoate);manganese(2+) |
|---|---|
| PubChem CID | 71587405 |
| Molecular Formula | C14H24MnN2O6S2 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | bis((2S)-2-acetamido-4-methylsulfanylbutanoate);manganese(2+) |
| SMILES | CSCC[C@H](NC(C)=O)C(=O)[O-].CSCC[C@H](NC(C)=O)C(=O)[O-].[Mn+2] |
| InChI | InChI=1S/2C7H13NO3S.Mn/c2*1-5(9)8-6(7(10)11)3-4-12-2;/h2*6H,3-4H2,1-2H3,(H,8,9)(H,10,11);/q;;+2/p-2/t2*6-;/m00./s1 |
| InChIKey | NCOMLKYSJHLANH-UAIGZDOSSA-L |
| XLogP | -2.01 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |