C16H21N2O4S- — CID 2282617
(2S)-2-[[(2R)-2-acetamido-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 2282617) has the molecular formula C16H21N2O4S- and a molecular weight of 337.42 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-acetamido-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | (2S)-2-[[(2R)-2-acetamido-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 2282617 |
| Molecular Formula | C16H21N2O4S- |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | (2S)-2-[[(2R)-2-acetamido-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)[C@@H](Cc1ccccc1)NC(C)=O)C(=O)[O-] |
| InChI | InChI=1S/C16H22N2O4S/c1-11(19)17-14(10-12-6-4-3-5-7-12)15(20)18-13(16(21)22)8-9-23-2/h3-7,13-14H,8-10H2,1-2H3,(H,17,19)(H,18,20)(H,21,22)/p-1/t13-,14+/m0/s1 |
| InChIKey | WKZUDETWSFSLBB-UONOGXRCSA-M |
| XLogP | -0.28 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |