C21H23N2O4S- — CID 2282514
(2S)-2-[[(2R)-2-benzamido-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 2282514) has the molecular formula C21H23N2O4S- and a molecular weight of 399.49 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-benzamido-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | (2S)-2-[[(2R)-2-benzamido-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 2282514 |
| Molecular Formula | C21H23N2O4S- |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | (2S)-2-[[(2R)-2-benzamido-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)[C@@H](Cc1ccccc1)NC(=O)c1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C21H24N2O4S/c1-28-13-12-17(21(26)27)22-20(25)18(14-15-8-4-2-5-9-15)23-19(24)16-10-6-3-7-11-16/h2-11,17-18H,12-14H2,1H3,(H,22,25)(H,23,24)(H,26,27)/p-1/t17-,18+/m0/s1 |
| InChIKey | FCZDJBFXGSPBAZ-ZWKOTPCHSA-M |
| XLogP | 1.02 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |