C12H24N2O5S2 — CID 87569304
(2S)-2-acetamido-4-methylsulfanylbutanoic acid;2-amino-4-methylsulfanylbutanoic acid (PubChem CID 87569304) has the molecular formula C12H24N2O5S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is (2S)-2-acetamido-4-methylsulfanylbutanoic acid;2-amino-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-acetamido-4-methylsulfanylbutanoic acid;2-amino-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 87569304 |
| Molecular Formula | C12H24N2O5S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | (2S)-2-acetamido-4-methylsulfanylbutanoic acid;2-amino-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(N)C(=O)O.CSCC[C@H](NC(C)=O)C(=O)O |
| InChI | InChI=1S/C7H13NO3S.C5H11NO2S/c1-5(9)8-6(7(10)11)3-4-12-2;1-9-3-2-4(6)5(7)8/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11);4H,2-3,6H2,1H3,(H,7,8)/t6-;/m0./s1 |
| InChIKey | SUTTWNQTIKMQSR-RGMNGODLSA-N |
| XLogP | 0.48 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |