C11H20NNaO3S2 — CID 141084424
sodium 3-[6,8-bis(sulfanyl)octanoylamino]propanoate (PubChem CID 141084424) has the molecular formula C11H20NNaO3S2 and a molecular weight of 301.41 g/mol. Its IUPAC name is sodium 3-[6,8-bis(sulfanyl)octanoylamino]propanoate.
| Compound Name | sodium 3-[6,8-bis(sulfanyl)octanoylamino]propanoate |
|---|---|
| PubChem CID | 141084424 |
| Molecular Formula | C11H20NNaO3S2 |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | sodium 3-[6,8-bis(sulfanyl)octanoylamino]propanoate |
| SMILES | O=C([O-])CCNC(=O)CCCCC(S)CCS.[Na+] |
| InChI | InChI=1S/C11H21NO3S2.Na/c13-10(12-7-5-11(14)15)4-2-1-3-9(17)6-8-16;/h9,16-17H,1-8H2,(H,12,13)(H,14,15);/q;+1/p-1 |
| InChIKey | USTIHFPBVFYCKV-UHFFFAOYSA-M |
| XLogP | -2.57 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|