About 6-sulfanyloctanoate
6-sulfanyloctanoate (PubChem CID 25203317) has the molecular formula C8H15O2S-
and a molecular weight of 175.27 g/mol. Its IUPAC name is 6-sulfanyloctanoate.
Molecular Properties
| Compound Name | 6-sulfanyloctanoate |
| PubChem CID | 25203317 |
| Molecular Formula | C8H15O2S- |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 6-sulfanyloctanoate |
| SMILES | CCC(S)CCCCC(=O)[O-] |
| InChI | InChI=1S/C8H16O2S/c1-2-7(11)5-3-4-6-8(9)10/h7,11H,2-6H2,1H3,(H,9,10)/p-1 |
| InChIKey | LABZAONVGARYLS-UHFFFAOYSA-M |
| XLogP | 1.01 |
| TPSA | 40.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6-sulfanyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-sulfanyloctanoate?
The IUPAC name of 6-sulfanyloctanoate (CID 25203317) is 6-sulfanyloctanoate.
What is the SMILES notation for 6-sulfanyloctanoate?
The canonical SMILES for 6-sulfanyloctanoate is CCC(S)CCCCC(=O)[O-].
What is the InChIKey of 6-sulfanyloctanoate?
The InChIKey is LABZAONVGARYLS-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16O2S/c1-2-7(11)5-3-4-6-8(9)10/h7,11H,2-6H2,1H3,(H,9,10)/p-1.
What are the key properties of 6-sulfanyloctanoate?
6-sulfanyloctanoate has a molecular weight of 175.27 g/mol, XLogP of 1.01, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-sulfanyloctanoate is sourced from PubChem (CID 25203317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).