About potassium 16-methyloctadecanoate
potassium 16-methyloctadecanoate (PubChem CID 23706023) has the molecular formula C19H37KO2
and a molecular weight of 336.60 g/mol. Its IUPAC name is potassium 16-methyloctadecanoate.
Molecular Properties
| Compound Name | potassium 16-methyloctadecanoate |
| PubChem CID | 23706023 |
| Molecular Formula | C19H37KO2 |
| Molecular Weight | 336.60 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | potassium 16-methyloctadecanoate |
| SMILES | CCC(C)CCCCCCCCCCCCCCC(=O)[O-].[K+] |
| InChI | InChI=1S/C19H38O2.K/c1-3-18(2)16-14-12-10-8-6-4-5-7-9-11-13-15-17-19(20)21;/h18H,3-17H2,1-2H3,(H,20,21);/q;+1/p-1 |
| InChIKey | IUDTVDQRLLNFNS-UHFFFAOYSA-M |
| XLogP | 2.25 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.60 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze potassium 16-methyloctadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 16-methyloctadecanoate?
The IUPAC name of potassium 16-methyloctadecanoate (CID 23706023) is potassium 16-methyloctadecanoate.
What is the SMILES notation for potassium 16-methyloctadecanoate?
The canonical SMILES for potassium 16-methyloctadecanoate is CCC(C)CCCCCCCCCCCCCCC(=O)[O-].[K+].
What is the InChIKey of potassium 16-methyloctadecanoate?
The InChIKey is IUDTVDQRLLNFNS-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H38O2.K/c1-3-18(2)16-14-12-10-8-6-4-5-7-9-11-13-15-17-19(20)21;/h18H,3-17H2,1-2H3,(H,20,21);/q;+1/p-1.
What are the key properties of potassium 16-methyloctadecanoate?
potassium 16-methyloctadecanoate has a molecular weight of 336.60 g/mol, XLogP of 2.25, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 16-methyloctadecanoate is sourced from PubChem (CID 23706023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).