About dipotassium;octadecanedioate
dipotassium;octadecanedioate (PubChem CID 141466899) has the molecular formula C18H32K2O4
and a molecular weight of 390.65 g/mol. Its IUPAC name is dipotassium;octadecanedioate.
Molecular Properties
| Compound Name | dipotassium;octadecanedioate |
| PubChem CID | 141466899 |
| Molecular Formula | C18H32K2O4 |
| Molecular Weight | 390.65 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | dipotassium;octadecanedioate |
| SMILES | O=C([O-])CCCCCCCCCCCCCCCCC(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C18H34O4.2K/c19-17(20)15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(21)22;;/h1-16H2,(H,19,20)(H,21,22);;/q;2*+1/p-2 |
| InChIKey | PQXNUPJWSSLXPC-UHFFFAOYSA-L |
| XLogP | -3.26 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.65 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;octadecanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;octadecanedioate?
The IUPAC name of dipotassium;octadecanedioate (CID 141466899) is dipotassium;octadecanedioate.
What is the SMILES notation for dipotassium;octadecanedioate?
The canonical SMILES for dipotassium;octadecanedioate is O=C([O-])CCCCCCCCCCCCCCCCC(=O)[O-].[K+].[K+].
What is the InChIKey of dipotassium;octadecanedioate?
The InChIKey is PQXNUPJWSSLXPC-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H34O4.2K/c19-17(20)15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(21)22;;/h1-16H2,(H,19,20)(H,21,22);;/q;2*+1/p-2.
What are the key properties of dipotassium;octadecanedioate?
dipotassium;octadecanedioate has a molecular weight of 390.65 g/mol, XLogP of -3.26, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;octadecanedioate is sourced from PubChem (CID 141466899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).