About calcium heptanedioate
calcium heptanedioate (PubChem CID 71587031) has the molecular formula C7H10CaO4
and a molecular weight of 198.23 g/mol. Its IUPAC name is calcium heptanedioate.
Molecular Properties
| Compound Name | calcium heptanedioate |
| PubChem CID | 71587031 |
| Molecular Formula | C7H10CaO4 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | calcium heptanedioate |
| SMILES | O=C([O-])CCCCCC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C7H12O4.Ca/c8-6(9)4-2-1-3-5-7(10)11;/h1-5H2,(H,8,9)(H,10,11);/q;+2/p-2 |
| InChIKey | USYJXNNLQOTDLW-UHFFFAOYSA-L |
| XLogP | -1.94 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze calcium heptanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium heptanedioate?
The IUPAC name of calcium heptanedioate (CID 71587031) is calcium heptanedioate.
What is the SMILES notation for calcium heptanedioate?
The canonical SMILES for calcium heptanedioate is O=C([O-])CCCCCC(=O)[O-].[Ca+2].
What is the InChIKey of calcium heptanedioate?
The InChIKey is USYJXNNLQOTDLW-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H12O4.Ca/c8-6(9)4-2-1-3-5-7(10)11;/h1-5H2,(H,8,9)(H,10,11);/q;+2/p-2.
What are the key properties of calcium heptanedioate?
calcium heptanedioate has a molecular weight of 198.23 g/mol, XLogP of -1.94, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium heptanedioate is sourced from PubChem (CID 71587031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).