About strontium hexanedioate
strontium hexanedioate (PubChem CID 134687758) has the molecular formula C6H8O4Sr
and a molecular weight of 231.75 g/mol. Its IUPAC name is strontium hexanedioate.
Molecular Properties
| Compound Name | strontium hexanedioate |
| PubChem CID | 134687758 |
| Molecular Formula | C6H8O4Sr |
| Molecular Weight | 231.75 g/mol |
| Exact Mass | 231.95 |
| IUPAC Name | strontium hexanedioate |
| SMILES | O=C([O-])CCCCC(=O)[O-].[Sr+2] |
| InChI | InChI=1S/C6H10O4.Sr/c7-5(8)3-1-2-4-6(9)10;/h1-4H2,(H,7,8)(H,9,10);/q;+2/p-2 |
| InChIKey | LTMDDMGNVZBECP-UHFFFAOYSA-L |
| XLogP | -2.33 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.75 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze strontium hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of strontium hexanedioate?
The IUPAC name of strontium hexanedioate (CID 134687758) is strontium hexanedioate.
What is the SMILES notation for strontium hexanedioate?
The canonical SMILES for strontium hexanedioate is O=C([O-])CCCCC(=O)[O-].[Sr+2].
What is the InChIKey of strontium hexanedioate?
The InChIKey is LTMDDMGNVZBECP-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H10O4.Sr/c7-5(8)3-1-2-4-6(9)10;/h1-4H2,(H,7,8)(H,9,10);/q;+2/p-2.
What are the key properties of strontium hexanedioate?
strontium hexanedioate has a molecular weight of 231.75 g/mol, XLogP of -2.33, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for strontium hexanedioate is sourced from PubChem (CID 134687758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).