About lithium;hexanedioate;hydron
lithium;hexanedioate;hydron (PubChem CID 87066964) has the molecular formula C6H9LiO4
and a molecular weight of 152.08 g/mol. Its IUPAC name is lithium;hexanedioate;hydron.
Molecular Properties
| Compound Name | lithium;hexanedioate;hydron |
| PubChem CID | 87066964 |
| Molecular Formula | C6H9LiO4 |
| Molecular Weight | 152.08 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | lithium;hexanedioate;hydron |
| SMILES | O=C([O-])CCCCC(=O)[O-].[H+].[Li+] |
| InChI | InChI=1S/C6H10O4.Li/c7-5(8)3-1-2-4-6(9)10;/h1-4H2,(H,7,8)(H,9,10);/q;+1/p-1 |
| InChIKey | UMGSQVCDARTNOO-UHFFFAOYSA-M |
| XLogP | -4.84 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.08 |
| LogP ≤ 5 | -4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze lithium;hexanedioate;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hexanedioate;hydron?
The IUPAC name of lithium;hexanedioate;hydron (CID 87066964) is lithium;hexanedioate;hydron.
What is the SMILES notation for lithium;hexanedioate;hydron?
The canonical SMILES for lithium;hexanedioate;hydron is O=C([O-])CCCCC(=O)[O-].[H+].[Li+].
What is the InChIKey of lithium;hexanedioate;hydron?
The InChIKey is UMGSQVCDARTNOO-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H10O4.Li/c7-5(8)3-1-2-4-6(9)10;/h1-4H2,(H,7,8)(H,9,10);/q;+1/p-1.
What are the key properties of lithium;hexanedioate;hydron?
lithium;hexanedioate;hydron has a molecular weight of 152.08 g/mol, XLogP of -4.84, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hexanedioate;hydron is sourced from PubChem (CID 87066964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).