About cadmium(2+);hexanedioate
cadmium(2+);hexanedioate (PubChem CID 19376883) has the molecular formula C6H8CdO4
and a molecular weight of 256.54 g/mol. Its IUPAC name is cadmium(2+);hexanedioate.
Molecular Properties
| Compound Name | cadmium(2+);hexanedioate |
| PubChem CID | 19376883 |
| Molecular Formula | C6H8CdO4 |
| Molecular Weight | 256.54 g/mol |
| Exact Mass | 257.95 |
| IUPAC Name | cadmium(2+);hexanedioate |
| SMILES | O=C([O-])CCCCC(=O)[O-].[Cd+2] |
| InChI | InChI=1S/C6H10O4.Cd/c7-5(8)3-1-2-4-6(9)10;/h1-4H2,(H,7,8)(H,9,10);/q;+2/p-2 |
| InChIKey | OLNRYKRSAMYMLK-UHFFFAOYSA-L |
| XLogP | -1.96 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.54 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cadmium(2+);hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);hexanedioate?
The IUPAC name of cadmium(2+);hexanedioate (CID 19376883) is cadmium(2+);hexanedioate.
What is the SMILES notation for cadmium(2+);hexanedioate?
The canonical SMILES for cadmium(2+);hexanedioate is O=C([O-])CCCCC(=O)[O-].[Cd+2].
What is the InChIKey of cadmium(2+);hexanedioate?
The InChIKey is OLNRYKRSAMYMLK-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H10O4.Cd/c7-5(8)3-1-2-4-6(9)10;/h1-4H2,(H,7,8)(H,9,10);/q;+2/p-2.
What are the key properties of cadmium(2+);hexanedioate?
cadmium(2+);hexanedioate has a molecular weight of 256.54 g/mol, XLogP of -1.96, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);hexanedioate is sourced from PubChem (CID 19376883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).