About disodium;undecanedioate
disodium;undecanedioate (PubChem CID 15107599) has the molecular formula C11H18Na2O4
and a molecular weight of 260.24 g/mol. Its IUPAC name is disodium;undecanedioate.
Molecular Properties
| Compound Name | disodium;undecanedioate |
| PubChem CID | 15107599 |
| Molecular Formula | C11H18Na2O4 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | disodium;undecanedioate |
| SMILES | O=C([O-])CCCCCCCCCC(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C11H20O4.2Na/c12-10(13)8-6-4-2-1-3-5-7-9-11(14)15;;/h1-9H2,(H,12,13)(H,14,15);;/q;2*+1/p-2 |
| InChIKey | RNQNXKPMVJOUKE-UHFFFAOYSA-L |
| XLogP | -5.99 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | -5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze disodium;undecanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;undecanedioate?
The IUPAC name of disodium;undecanedioate (CID 15107599) is disodium;undecanedioate.
What is the SMILES notation for disodium;undecanedioate?
The canonical SMILES for disodium;undecanedioate is O=C([O-])CCCCCCCCCC(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;undecanedioate?
The InChIKey is RNQNXKPMVJOUKE-UHFFFAOYSA-L. The full InChI is InChI=1S/C11H20O4.2Na/c12-10(13)8-6-4-2-1-3-5-7-9-11(14)15;;/h1-9H2,(H,12,13)(H,14,15);;/q;2*+1/p-2.
What are the key properties of disodium;undecanedioate?
disodium;undecanedioate has a molecular weight of 260.24 g/mol, XLogP of -5.99, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;undecanedioate is sourced from PubChem (CID 15107599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).