About magnesium hexanedioate
magnesium hexanedioate (PubChem CID 24074) has the molecular formula C6H8MgO4
and a molecular weight of 168.43 g/mol. Its IUPAC name is magnesium hexanedioate.
Molecular Properties
| Compound Name | magnesium hexanedioate |
| PubChem CID | 24074 |
| Molecular Formula | C6H8MgO4 |
| Molecular Weight | 168.43 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | magnesium hexanedioate |
| SMILES | O=C([O-])CCCCC(=O)[O-].[Mg+2] |
| InChI | InChI=1S/C6H10O4.Mg/c7-5(8)3-1-2-4-6(9)10;/h1-4H2,(H,7,8)(H,9,10);/q;+2/p-2 |
| InChIKey | QXNFATVALXHNRJ-UHFFFAOYSA-L |
| XLogP | -2.33 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.43 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze magnesium hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium hexanedioate?
The IUPAC name of magnesium hexanedioate (CID 24074) is magnesium hexanedioate.
What is the SMILES notation for magnesium hexanedioate?
The canonical SMILES for magnesium hexanedioate is O=C([O-])CCCCC(=O)[O-].[Mg+2].
What is the InChIKey of magnesium hexanedioate?
The InChIKey is QXNFATVALXHNRJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H10O4.Mg/c7-5(8)3-1-2-4-6(9)10;/h1-4H2,(H,7,8)(H,9,10);/q;+2/p-2.
What are the key properties of magnesium hexanedioate?
magnesium hexanedioate has a molecular weight of 168.43 g/mol, XLogP of -2.33, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium hexanedioate is sourced from PubChem (CID 24074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).