About tridecanedioate
tridecanedioate (PubChem CID 6994474) has the molecular formula C13H22O4-2
and a molecular weight of 242.31 g/mol. Its IUPAC name is tridecanedioate.
Molecular Properties
| Compound Name | tridecanedioate |
| PubChem CID | 6994474 |
| Molecular Formula | C13H22O4-2 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | tridecanedioate |
| SMILES | O=C([O-])CCCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C13H24O4/c14-12(15)10-8-6-4-2-1-3-5-7-9-11-13(16)17/h1-11H2,(H,14,15)(H,16,17)/p-2 |
| InChIKey | DXNCZXXFRKPEPY-UHFFFAOYSA-L |
| XLogP | 0.78 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tridecanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tridecanedioate?
The IUPAC name of tridecanedioate (CID 6994474) is tridecanedioate.
What is the SMILES notation for tridecanedioate?
The canonical SMILES for tridecanedioate is O=C([O-])CCCCCCCCCCCC(=O)[O-].
What is the InChIKey of tridecanedioate?
The InChIKey is DXNCZXXFRKPEPY-UHFFFAOYSA-L. The full InChI is InChI=1S/C13H24O4/c14-12(15)10-8-6-4-2-1-3-5-7-9-11-13(16)17/h1-11H2,(H,14,15)(H,16,17)/p-2.
What are the key properties of tridecanedioate?
tridecanedioate has a molecular weight of 242.31 g/mol, XLogP of 0.78, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tridecanedioate is sourced from PubChem (CID 6994474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).