About diazanium;decanedioate;tetrahydrate
diazanium;decanedioate;tetrahydrate (PubChem CID 164522068) has the molecular formula C10H32N2O8
and a molecular weight of 308.37 g/mol. Its IUPAC name is diazanium;decanedioate;tetrahydrate.
Molecular Properties
| Compound Name | diazanium;decanedioate;tetrahydrate |
| PubChem CID | 164522068 |
| Molecular Formula | C10H32N2O8 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | diazanium;decanedioate;tetrahydrate |
| SMILES | O.O.O.O.O=C([O-])CCCCCCCCC(=O)[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C10H18O4.2H3N.4H2O/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;;;;;;/h1-8H2,(H,11,12)(H,13,14);2*1H3;4*1H2 |
| InChIKey | XNHXAALRHCSTKK-UHFFFAOYSA-N |
| XLogP | -2.94 |
| TPSA | 279.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze diazanium;decanedioate;tetrahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;decanedioate;tetrahydrate?
The IUPAC name of diazanium;decanedioate;tetrahydrate (CID 164522068) is diazanium;decanedioate;tetrahydrate.
What is the SMILES notation for diazanium;decanedioate;tetrahydrate?
The canonical SMILES for diazanium;decanedioate;tetrahydrate is O.O.O.O.O=C([O-])CCCCCCCCC(=O)[O-].[NH4+].[NH4+].
What is the InChIKey of diazanium;decanedioate;tetrahydrate?
The InChIKey is XNHXAALRHCSTKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4.2H3N.4H2O/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;;;;;;/h1-8H2,(H,11,12)(H,13,14);2*1H3;4*1H2.
What are the key properties of diazanium;decanedioate;tetrahydrate?
diazanium;decanedioate;tetrahydrate has a molecular weight of 308.37 g/mol, XLogP of -2.94, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;decanedioate;tetrahydrate is sourced from PubChem (CID 164522068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).