About azanium;heptanoate;tetrahydrate
azanium;heptanoate;tetrahydrate (PubChem CID 172723496) has the molecular formula C7H25NO6
and a molecular weight of 219.28 g/mol. Its IUPAC name is azanium;heptanoate;tetrahydrate.
Molecular Properties
| Compound Name | azanium;heptanoate;tetrahydrate |
| PubChem CID | 172723496 |
| Molecular Formula | C7H25NO6 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | azanium;heptanoate;tetrahydrate |
| SMILES | CCCCCCC(=O)[O-].O.O.O.O.[NH4+] |
| InChI | InChI=1S/C7H14O2.H3N.4H2O/c1-2-3-4-5-6-7(8)9;;;;;/h2-6H2,1H3,(H,8,9);1H3;4*1H2 |
| InChIKey | GVHSWVSBNIATDX-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 202.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azanium;heptanoate;tetrahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;heptanoate;tetrahydrate?
The IUPAC name of azanium;heptanoate;tetrahydrate (CID 172723496) is azanium;heptanoate;tetrahydrate.
What is the SMILES notation for azanium;heptanoate;tetrahydrate?
The canonical SMILES for azanium;heptanoate;tetrahydrate is CCCCCCC(=O)[O-].O.O.O.O.[NH4+].
What is the InChIKey of azanium;heptanoate;tetrahydrate?
The InChIKey is GVHSWVSBNIATDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2.H3N.4H2O/c1-2-3-4-5-6-7(8)9;;;;;/h2-6H2,1H3,(H,8,9);1H3;4*1H2.
What are the key properties of azanium;heptanoate;tetrahydrate?
azanium;heptanoate;tetrahydrate has a molecular weight of 219.28 g/mol, XLogP of -2.22, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;heptanoate;tetrahydrate is sourced from PubChem (CID 172723496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).