About diazanium;ethanolate;nonanoate
diazanium;ethanolate;nonanoate (PubChem CID 141132654) has the molecular formula C11H30N2O3
and a molecular weight of 238.37 g/mol. Its IUPAC name is diazanium;ethanolate;nonanoate.
Molecular Properties
| Compound Name | diazanium;ethanolate;nonanoate |
| PubChem CID | 141132654 |
| Molecular Formula | C11H30N2O3 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | diazanium;ethanolate;nonanoate |
| SMILES | CCCCCCCCC(=O)[O-].CC[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C9H18O2.C2H5O.2H3N/c1-2-3-4-5-6-7-8-9(10)11;1-2-3;;/h2-8H2,1H3,(H,10,11);2H2,1H3;2*1H3/q;-1;;/p+1 |
| InChIKey | CQGTVUKXYIREHN-UHFFFAOYSA-O |
| XLogP | 1.61 |
| TPSA | 136.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze diazanium;ethanolate;nonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;ethanolate;nonanoate?
The IUPAC name of diazanium;ethanolate;nonanoate (CID 141132654) is diazanium;ethanolate;nonanoate.
What is the SMILES notation for diazanium;ethanolate;nonanoate?
The canonical SMILES for diazanium;ethanolate;nonanoate is CCCCCCCCC(=O)[O-].CC[O-].[NH4+].[NH4+].
What is the InChIKey of diazanium;ethanolate;nonanoate?
The InChIKey is CQGTVUKXYIREHN-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H18O2.C2H5O.2H3N/c1-2-3-4-5-6-7-8-9(10)11;1-2-3;;/h2-8H2,1H3,(H,10,11);2H2,1H3;2*1H3/q;-1;;/p+1.
What are the key properties of diazanium;ethanolate;nonanoate?
diazanium;ethanolate;nonanoate has a molecular weight of 238.37 g/mol, XLogP of 1.61, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;ethanolate;nonanoate is sourced from PubChem (CID 141132654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).